C31H30F3N3O4S — CID 171558083
1-[4-[5-[[3-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]methyl]thiophen-2-yl]phenyl]butan-1-one (PubChem CID 171558083) has the molecular formula C31H30F3N3O4S and a molecular weight of 597.66 g/mol. Its IUPAC name is 1-[4-[5-[[3-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]methyl]thiophen-2-yl]phenyl]butan-1-one.
| Compound Name | 1-[4-[5-[[3-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]methyl]thiophen-2-yl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 171558083 |
| Molecular Formula | C31H30F3N3O4S |
| Molecular Weight | 597.66 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | 1-[4-[5-[[3-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]methyl]thiophen-2-yl]phenyl]butan-1-one |
| SMILES | CCCC(=O)c1ccc(-c2ccc(Cc3cccc([C@H]4OC[C@H](O)[C@H](O)[C@H]4Nc4cncc(C(F)(F)F)n4)c3)s2)cc1 |
| InChI | InChI=1S/C31H30F3N3O4S/c1-2-4-23(38)19-7-9-20(10-8-19)25-12-11-22(42-25)14-18-5-3-6-21(13-18)30-28(29(40)24(39)17-41-30)37-27-16-35-15-26(36-27)31(32,33)34/h3,5-13,15-16,24,28-30,39-40H,2,4,14,17H2,1H3,(H,36,37)/t24-,28+,29-,30+/m0/s1 |
| InChIKey | NOYXKZQCEUITJJ-NDMKBUGQSA-N |
| XLogP | 6.07 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.66 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |