C22H26F3N3O4 — CID 178008346
1-[4-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]-4-methylpentan-3-one (PubChem CID 178008346) has the molecular formula C22H26F3N3O4 and a molecular weight of 453.46 g/mol. Its IUPAC name is 1-[4-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]-4-methylpentan-3-one.
| Compound Name | 1-[4-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]-4-methylpentan-3-one |
|---|---|
| PubChem CID | 178008346 |
| Molecular Formula | C22H26F3N3O4 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1-[4-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]-4-methylpentan-3-one |
| SMILES | CC(C)C(=O)CCc1ccc([C@H]2OC[C@H](O)[C@H](O)[C@H]2Nc2cncc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C22H26F3N3O4/c1-12(2)15(29)8-5-13-3-6-14(7-4-13)21-19(20(31)16(30)11-32-21)28-18-10-26-9-17(27-18)22(23,24)25/h3-4,6-7,9-10,12,16,19-21,30-31H,5,8,11H2,1-2H3,(H,27,28)/t16-,19+,20-,21+/m0/s1 |
| InChIKey | CYQZQGDDDMXABF-NASSWSRMSA-N |
| XLogP | 2.93 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |