C21H24F3N3O4 — CID 171556883
(2R,3R,4R,6R)-6-phenyl-2-(propan-2-yloxymethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol (PubChem CID 171556883) has the molecular formula C21H24F3N3O4 and a molecular weight of 439.43 g/mol. Its IUPAC name is (2R,3R,4R,6R)-6-phenyl-2-(propan-2-yloxymethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,6R)-6-phenyl-2-(propan-2-yloxymethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 171556883 |
| Molecular Formula | C21H24F3N3O4 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (2R,3R,4R,6R)-6-phenyl-2-(propan-2-yloxymethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]iminomethyl]oxane-3,4-diol |
| SMILES | CC(C)OC[C@H]1O[C@@H](c2ccccc2)C(/C=N/c2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H24F3N3O4/c1-12(2)30-11-15-19(29)18(28)14(20(31-15)13-6-4-3-5-7-13)8-26-17-10-25-9-16(27-17)21(22,23)24/h3-10,12,14-15,18-20,28-29H,11H2,1-2H3/b26-8+/t14?,15-,18-,19+,20+/m1/s1 |
| InChIKey | SZUFRNXDUYSPLD-VWELJDSJSA-N |
| XLogP | 3.10 |
| TPSA | 97.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|