C20H24F3N3O3 — CID 178007508
(2R,3R,4R,5R,6R)-2-(2-methylpropyl)-6-phenyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 178007508) has the molecular formula C20H24F3N3O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-(2-methylpropyl)-6-phenyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6R)-2-(2-methylpropyl)-6-phenyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 178007508 |
| Molecular Formula | C20H24F3N3O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-(2-methylpropyl)-6-phenyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | CC(C)C[C@H]1O[C@H](c2ccccc2)[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H24F3N3O3/c1-11(2)8-13-17(27)18(28)16(19(29-13)12-6-4-3-5-7-12)26-15-10-24-9-14(25-15)20(21,22)23/h3-7,9-11,13,16-19,27-28H,8H2,1-2H3,(H,25,26)/t13-,16-,17+,18-,19-/m1/s1 |
| InChIKey | PMLRBHDKKNCSSK-LQDZTQBFSA-N |
| XLogP | 3.18 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |