C17H19F2N3O4 — CID 171558511
(2R,3R,4R,5R,6S)-5-[[6-(difluoromethyl)pyrazin-2-yl]amino]-2-(hydroxymethyl)-6-phenyloxane-3,4-diol (PubChem CID 171558511) has the molecular formula C17H19F2N3O4 and a molecular weight of 367.35 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-5-[[6-(difluoromethyl)pyrazin-2-yl]amino]-2-(hydroxymethyl)-6-phenyloxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-5-[[6-(difluoromethyl)pyrazin-2-yl]amino]-2-(hydroxymethyl)-6-phenyloxane-3,4-diol |
|---|---|
| PubChem CID | 171558511 |
| Molecular Formula | C17H19F2N3O4 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (2R,3R,4R,5R,6S)-5-[[6-(difluoromethyl)pyrazin-2-yl]amino]-2-(hydroxymethyl)-6-phenyloxane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](c2ccccc2)[C@H](Nc2cncc(C(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H19F2N3O4/c18-17(19)10-6-20-7-12(21-10)22-13-15(25)14(24)11(8-23)26-16(13)9-4-2-1-3-5-9/h1-7,11,13-17,23-25H,8H2,(H,21,22)/t11-,13-,14+,15-,16+/m1/s1 |
| InChIKey | PODQTJIGUAYBBO-JZYAIQKZSA-N |
| XLogP | 1.05 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |