C31H28F3N3O4S — CID 178008186
cyclopropyl-[4-[5-[[3-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]methyl]thiophen-2-yl]phenyl]methanone (PubChem CID 178008186) has the molecular formula C31H28F3N3O4S and a molecular weight of 595.64 g/mol. Its IUPAC name is cyclopropyl-[4-[5-[[3-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]methyl]thiophen-2-yl]phenyl]methanone.
| Compound Name | cyclopropyl-[4-[5-[[3-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]methyl]thiophen-2-yl]phenyl]methanone |
|---|---|
| PubChem CID | 178008186 |
| Molecular Formula | C31H28F3N3O4S |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | cyclopropyl-[4-[5-[[3-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]methyl]thiophen-2-yl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(Cc3cccc([C@H]4OC[C@H](O)[C@H](O)[C@H]4Nc4cncc(C(F)(F)F)n4)c3)s2)cc1)C1CC1 |
| InChI | InChI=1S/C31H28F3N3O4S/c32-31(33,34)25-14-35-15-26(36-25)37-27-29(40)23(38)16-41-30(27)21-3-1-2-17(12-21)13-22-10-11-24(42-22)18-4-6-19(7-5-18)28(39)20-8-9-20/h1-7,10-12,14-15,20,23,27,29-30,38,40H,8-9,13,16H2,(H,36,37)/t23-,27+,29-,30+/m0/s1 |
| InChIKey | RCVRQSOWQQCZQQ-YQXNOVQFSA-N |
| XLogP | 5.68 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |