C18H24F3N5O3 — CID 171558208
(3aS,4R,7aR)-2,2-dimethyl-4-(piperazin-1-ylmethyl)-N-[6-(trifluoromethyl)pyrazin-2-yl]-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-imine (PubChem CID 171558208) has the molecular formula C18H24F3N5O3 and a molecular weight of 415.42 g/mol. Its IUPAC name is (3aS,4R,7aR)-2,2-dimethyl-4-(piperazin-1-ylmethyl)-N-[6-(trifluoromethyl)pyrazin-2-yl]-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-imine.
| Compound Name | (3aS,4R,7aR)-2,2-dimethyl-4-(piperazin-1-ylmethyl)-N-[6-(trifluoromethyl)pyrazin-2-yl]-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-imine |
|---|---|
| PubChem CID | 171558208 |
| Molecular Formula | C18H24F3N5O3 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (3aS,4R,7aR)-2,2-dimethyl-4-(piperazin-1-ylmethyl)-N-[6-(trifluoromethyl)pyrazin-2-yl]-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-imine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)/C(=N/c1cncc(C(F)(F)F)n1)CO[C@@H]2CN1CCNCC1 |
| InChI | InChI=1S/C18H24F3N5O3/c1-17(2)28-15-11(24-14-8-23-7-13(25-14)18(19,20)21)10-27-12(16(15)29-17)9-26-5-3-22-4-6-26/h7-8,12,15-16,22H,3-6,9-10H2,1-2H3/b24-11+/t12-,15-,16+/m1/s1 |
| InChIKey | BDNHLXJGLRCTQO-NUDDYKHDSA-N |
| XLogP | 1.39 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|