C23H33F3N4O9 — CID 171558261
methyl 2-[2-[2-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]ethoxy]acetate (PubChem CID 171558261) has the molecular formula C23H33F3N4O9 and a molecular weight of 566.53 g/mol. Its IUPAC name is methyl 2-[2-[2-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]ethoxy]acetate.
| Compound Name | methyl 2-[2-[2-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 171558261 |
| Molecular Formula | C23H33F3N4O9 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | methyl 2-[2-[2-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]ethoxy]acetate |
| SMILES | COC(=O)COCCOCCOCC(=O)NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C23H33F3N4O9/c1-22(2)38-20-14(29-17-10-27-9-16(30-17)23(24,25)26)11-37-15(21(20)39-22)8-28-18(31)12-35-6-4-34-5-7-36-13-19(32)33-3/h9-10,14-15,20-21H,4-8,11-13H2,1-3H3,(H,28,31)(H,29,30)/t14-,15+,20+,21-/m0/s1 |
| InChIKey | WYXNMJWOWUQRSH-RSMHBEIYSA-N |
| XLogP | 0.53 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|