C26H31F3N4O5 — CID 171558849
benzyl 6-[(3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]-6-oxohexanoate (PubChem CID 171558849) has the molecular formula C26H31F3N4O5 and a molecular weight of 536.55 g/mol. Its IUPAC name is benzyl 6-[(3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]-6-oxohexanoate.
| Compound Name | benzyl 6-[(3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]-6-oxohexanoate |
|---|---|
| PubChem CID | 171558849 |
| Molecular Formula | C26H31F3N4O5 |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | benzyl 6-[(3aS,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl]-6-oxohexanoate |
| SMILES | CC1(C)O[C@@H]2[C@@H](Nc3cncc(C(F)(F)F)n3)CN(C(=O)CCCCC(=O)OCc3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C26H31F3N4O5/c1-25(2)37-19-15-33(22(34)10-6-7-11-23(35)36-16-17-8-4-3-5-9-17)14-18(24(19)38-25)31-21-13-30-12-20(32-21)26(27,28)29/h3-5,8-9,12-13,18-19,24H,6-7,10-11,14-16H2,1-2H3,(H,31,32)/t18-,19-,24+/m0/s1 |
| InChIKey | WDTMMWNVWZLKNS-AXHZCLLHSA-N |
| XLogP | 3.94 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|