About magnesium methylsulfonylazanide
magnesium methylsulfonylazanide (PubChem CID 171559511) has the molecular formula C2H8MgN2O4S2
and a molecular weight of 212.53 g/mol. Its IUPAC name is magnesium methylsulfonylazanide.
Molecular Properties
| Compound Name | magnesium methylsulfonylazanide |
|---|
| PubChem CID | 171559511 |
|---|
| Molecular Formula | C2H8MgN2O4S2 |
|---|
| Molecular Weight | 212.53 g/mol |
|---|
| Exact Mass | 211.98 |
|---|
| IUPAC Name | magnesium methylsulfonylazanide |
|---|
| SMILES | CS([NH-])(=O)=O.CS([NH-])(=O)=O.[Mg+2] |
|---|
| InChI | InChI=1S/2CH4NO2S.Mg/c2*1-5(2,3)4;/h2*1H3,(H-,2,3,4);/q2*-1;+2 |
|---|
| InChIKey | WBTVUABCTIHGAL-UHFFFAOYSA-N |
|---|
| XLogP | -0.38 |
|---|
| TPSA | 115.88 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 4 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 11 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 212.53 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze magnesium methylsulfonylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium methylsulfonylazanide?
The IUPAC name of magnesium methylsulfonylazanide (CID 171559511) is magnesium methylsulfonylazanide.
What is the SMILES notation for magnesium methylsulfonylazanide?
The canonical SMILES for magnesium methylsulfonylazanide is CS([NH-])(=O)=O.CS([NH-])(=O)=O.[Mg+2].
What is the InChIKey of magnesium methylsulfonylazanide?
The InChIKey is WBTVUABCTIHGAL-UHFFFAOYSA-N. The full InChI is InChI=1S/2CH4NO2S.Mg/c2*1-5(2,3)4;/h2*1H3,(H-,2,3,4);/q2*-1;+2.
What are the key properties of magnesium methylsulfonylazanide?
magnesium methylsulfonylazanide has a molecular weight of 212.53 g/mol, XLogP of -0.38, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium methylsulfonylazanide is sourced from PubChem (CID 171559511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).