C23H32N4O2 — CID 171563085
N-[4-[2-(4-ethoxy-3-ethylphenyl)pyrimidin-4-yl]butanimidoyl]-N-ethylpropanamide (PubChem CID 171563085) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is N-[4-[2-(4-ethoxy-3-ethylphenyl)pyrimidin-4-yl]butanimidoyl]-N-ethylpropanamide.
| Compound Name | N-[4-[2-(4-ethoxy-3-ethylphenyl)pyrimidin-4-yl]butanimidoyl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 171563085 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | N-[4-[2-(4-ethoxy-3-ethylphenyl)pyrimidin-4-yl]butanimidoyl]-N-ethylpropanamide |
| SMILES | [H]/N=C(/CCCc1ccnc(-c2ccc(OCC)c(CC)c2)n1)N(CC)C(=O)CC |
| InChI | InChI=1S/C23H32N4O2/c1-5-17-16-18(12-13-20(17)29-8-4)23-25-15-14-19(26-23)10-9-11-21(24)27(7-3)22(28)6-2/h12-16,24H,5-11H2,1-4H3/b24-21- |
| InChIKey | AATXYCZTYUMNHG-FLFQWRMESA-N |
| XLogP | 4.66 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|