C36H47N3O4 — CID 129090714
2-[2-butoxy-5-[4-[4-[(4-tert-butylphenyl)methylcarbamoyl-ethylamino]-4-iminobutyl]phenyl]phenyl]acetic acid (PubChem CID 129090714) has the molecular formula C36H47N3O4 and a molecular weight of 585.79 g/mol. Its IUPAC name is 2-[2-butoxy-5-[4-[4-[(4-tert-butylphenyl)methylcarbamoyl-ethylamino]-4-iminobutyl]phenyl]phenyl]acetic acid.
| Compound Name | 2-[2-butoxy-5-[4-[4-[(4-tert-butylphenyl)methylcarbamoyl-ethylamino]-4-iminobutyl]phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 129090714 |
| Molecular Formula | C36H47N3O4 |
| Molecular Weight | 585.79 g/mol |
| Exact Mass | 585.36 |
| IUPAC Name | 2-[2-butoxy-5-[4-[4-[(4-tert-butylphenyl)methylcarbamoyl-ethylamino]-4-iminobutyl]phenyl]phenyl]acetic acid |
| SMILES | [H]/N=C(/CCCc1ccc(-c2ccc(OCCCC)c(CC(=O)O)c2)cc1)N(CC)C(=O)NCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C36H47N3O4/c1-6-8-22-43-32-21-18-29(23-30(32)24-34(40)41)28-16-12-26(13-17-28)10-9-11-33(37)39(7-2)35(42)38-25-27-14-19-31(20-15-27)36(3,4)5/h12-21,23,37H,6-11,22,24-25H2,1-5H3,(H,38,42)(H,40,41)/b37-33- |
| InChIKey | OUOBXEHBEOHFTL-FJSCPDHXSA-N |
| XLogP | 7.99 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.79 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|