C31H37F3N4O — CID 129090364
1-[4-[4-[3-amino-4-(trifluoromethyl)phenyl]phenyl]butanimidoyl]-3-[(4-tert-butylphenyl)methyl]-1-ethylurea (PubChem CID 129090364) has the molecular formula C31H37F3N4O and a molecular weight of 538.66 g/mol. Its IUPAC name is 1-[4-[4-[3-amino-4-(trifluoromethyl)phenyl]phenyl]butanimidoyl]-3-[(4-tert-butylphenyl)methyl]-1-ethylurea.
| Compound Name | 1-[4-[4-[3-amino-4-(trifluoromethyl)phenyl]phenyl]butanimidoyl]-3-[(4-tert-butylphenyl)methyl]-1-ethylurea |
|---|---|
| PubChem CID | 129090364 |
| Molecular Formula | C31H37F3N4O |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | 1-[4-[4-[3-amino-4-(trifluoromethyl)phenyl]phenyl]butanimidoyl]-3-[(4-tert-butylphenyl)methyl]-1-ethylurea |
| SMILES | [H]/N=C(/CCCc1ccc(-c2ccc(C(F)(F)F)c(N)c2)cc1)N(CC)C(=O)NCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H37F3N4O/c1-5-38(29(39)37-20-22-11-16-25(17-12-22)30(2,3)4)28(36)8-6-7-21-9-13-23(14-10-21)24-15-18-26(27(35)19-24)31(32,33)34/h9-19,36H,5-8,20,35H2,1-4H3,(H,37,39)/b36-28- |
| InChIKey | SZFINPDCVRDBRH-DKJXEYTPSA-N |
| XLogP | 7.78 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|