C30H39N5O — CID 129090367
3-[(4-tert-butylphenyl)methyl]-1-ethyl-1-[4-[4-[6-(methylamino)-2-pyridinyl]phenyl]butanimidoyl]urea (PubChem CID 129090367) has the molecular formula C30H39N5O and a molecular weight of 485.68 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)methyl]-1-ethyl-1-[4-[4-[6-(methylamino)-2-pyridinyl]phenyl]butanimidoyl]urea.
| Compound Name | 3-[(4-tert-butylphenyl)methyl]-1-ethyl-1-[4-[4-[6-(methylamino)-2-pyridinyl]phenyl]butanimidoyl]urea |
|---|---|
| PubChem CID | 129090367 |
| Molecular Formula | C30H39N5O |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.32 |
| IUPAC Name | 3-[(4-tert-butylphenyl)methyl]-1-ethyl-1-[4-[4-[6-(methylamino)-2-pyridinyl]phenyl]butanimidoyl]urea |
| SMILES | [H]/N=C(\CCCc1ccc(-c2cccc(NC)n2)cc1)N(CC)C(=O)NCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H39N5O/c1-6-35(29(36)33-21-23-15-19-25(20-16-23)30(2,3)4)27(31)11-7-9-22-13-17-24(18-14-22)26-10-8-12-28(32-5)34-26/h8,10,12-20,31H,6-7,9,11,21H2,1-5H3,(H,32,34)(H,33,36)/b31-27+ |
| InChIKey | DNPRCJLXZGDORD-TVKQRKNISA-N |
| XLogP | 6.62 |
| TPSA | 81.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|