C38H52N2O4 — CID 171563053
1-tert-butyl-4-ethylbenzene;2-[5-[3-[4-[ethyl(propanoyl)amino]-4-iminobutyl]phenyl]-2-propoxyphenyl]acetic acid (PubChem CID 171563053) has the molecular formula C38H52N2O4 and a molecular weight of 600.84 g/mol. Its IUPAC name is 1-tert-butyl-4-ethylbenzene;2-[5-[3-[4-[ethyl(propanoyl)amino]-4-iminobutyl]phenyl]-2-propoxyphenyl]acetic acid.
| Compound Name | 1-tert-butyl-4-ethylbenzene;2-[5-[3-[4-[ethyl(propanoyl)amino]-4-iminobutyl]phenyl]-2-propoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 171563053 |
| Molecular Formula | C38H52N2O4 |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 600.39 |
| IUPAC Name | 1-tert-butyl-4-ethylbenzene;2-[5-[3-[4-[ethyl(propanoyl)amino]-4-iminobutyl]phenyl]-2-propoxyphenyl]acetic acid |
| SMILES | CCc1ccc(C(C)(C)C)cc1.[H]/N=C(/CCCc1cccc(-c2ccc(OCCC)c(CC(=O)O)c2)c1)N(CC)C(=O)CC |
| InChI | InChI=1S/C26H34N2O4.C12H18/c1-4-15-32-23-14-13-21(17-22(23)18-26(30)31)20-11-7-9-19(16-20)10-8-12-24(27)28(6-3)25(29)5-2;1-5-10-6-8-11(9-7-10)12(2,3)4/h7,9,11,13-14,16-17,27H,4-6,8,10,12,15,18H2,1-3H3,(H,30,31);6-9H,5H2,1-4H3/b27-24-; |
| InChIKey | XIJMPYNXCYCZKY-XLKZBTFOSA-N |
| XLogP | 8.87 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|