C23H28N2O4 — CID 174324699
5-[3-[4-[ethyl(propanoyl)amino]-4-iminobutyl]phenyl]-2-methoxybenzoic acid (PubChem CID 174324699) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 5-[3-[4-[ethyl(propanoyl)amino]-4-iminobutyl]phenyl]-2-methoxybenzoic acid.
| Compound Name | 5-[3-[4-[ethyl(propanoyl)amino]-4-iminobutyl]phenyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 174324699 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 5-[3-[4-[ethyl(propanoyl)amino]-4-iminobutyl]phenyl]-2-methoxybenzoic acid |
| SMILES | [H]/N=C(/CCCc1cccc(-c2ccc(OC)c(C(=O)O)c2)c1)N(CC)C(=O)CC |
| InChI | InChI=1S/C23H28N2O4/c1-4-22(26)25(5-2)21(24)11-7-9-16-8-6-10-17(14-16)18-12-13-20(29-3)19(15-18)23(27)28/h6,8,10,12-15,24H,4-5,7,9,11H2,1-3H3,(H,27,28)/b24-21- |
| InChIKey | UREJDMVQOQLDMP-FLFQWRMESA-N |
| XLogP | 4.62 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|