C27H36N2O4 — CID 171563079
2-[5-[3-[4-[butanoyl(ethyl)amino]-4-iminobutyl]phenyl]-2-propoxyphenyl]acetic acid (PubChem CID 171563079) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2-[5-[3-[4-[butanoyl(ethyl)amino]-4-iminobutyl]phenyl]-2-propoxyphenyl]acetic acid.
| Compound Name | 2-[5-[3-[4-[butanoyl(ethyl)amino]-4-iminobutyl]phenyl]-2-propoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 171563079 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 2-[5-[3-[4-[butanoyl(ethyl)amino]-4-iminobutyl]phenyl]-2-propoxyphenyl]acetic acid |
| SMILES | [H]/N=C(/CCCc1cccc(-c2ccc(OCCC)c(CC(=O)O)c2)c1)N(CC)C(=O)CCC |
| InChI | InChI=1S/C27H36N2O4/c1-4-9-26(30)29(6-3)25(28)13-8-11-20-10-7-12-21(17-20)22-14-15-24(33-16-5-2)23(18-22)19-27(31)32/h7,10,12,14-15,17-18,28H,4-6,8-9,11,13,16,19H2,1-3H3,(H,31,32)/b28-25- |
| InChIKey | QAHQSCUGFRRFDP-FVDSYPCUSA-N |
| XLogP | 5.72 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|