C20H19F3N4O4 — CID 171566301
3-[5-(hydroxymethyl)imidazol-1-yl]-5-(2-methoxyethoxy)-N-[2-(trifluoromethyl)-4-pyridinyl]benzamide (PubChem CID 171566301) has the molecular formula C20H19F3N4O4 and a molecular weight of 436.39 g/mol. Its IUPAC name is 3-[5-(hydroxymethyl)imidazol-1-yl]-5-(2-methoxyethoxy)-N-[2-(trifluoromethyl)-4-pyridinyl]benzamide.
| Compound Name | 3-[5-(hydroxymethyl)imidazol-1-yl]-5-(2-methoxyethoxy)-N-[2-(trifluoromethyl)-4-pyridinyl]benzamide |
|---|---|
| PubChem CID | 171566301 |
| Molecular Formula | C20H19F3N4O4 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 3-[5-(hydroxymethyl)imidazol-1-yl]-5-(2-methoxyethoxy)-N-[2-(trifluoromethyl)-4-pyridinyl]benzamide |
| SMILES | COCCOc1cc(C(=O)Nc2ccnc(C(F)(F)F)c2)cc(-n2cncc2CO)c1 |
| InChI | InChI=1S/C20H19F3N4O4/c1-30-4-5-31-17-7-13(6-15(9-17)27-12-24-10-16(27)11-28)19(29)26-14-2-3-25-18(8-14)20(21,22)23/h2-3,6-10,12,28H,4-5,11H2,1H3,(H,25,26,29) |
| InChIKey | XRUBJRJKWHAFGO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|