C22H21F3N4O5 — CID 171566284
ethyl 3-[3-(2-methoxyethoxy)-5-[[2-(trifluoromethyl)-4-pyridinyl]carbamoyl]phenyl]imidazole-4-carboxylate (PubChem CID 171566284) has the molecular formula C22H21F3N4O5 and a molecular weight of 478.43 g/mol. Its IUPAC name is ethyl 3-[3-(2-methoxyethoxy)-5-[[2-(trifluoromethyl)-4-pyridinyl]carbamoyl]phenyl]imidazole-4-carboxylate.
| Compound Name | ethyl 3-[3-(2-methoxyethoxy)-5-[[2-(trifluoromethyl)-4-pyridinyl]carbamoyl]phenyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 171566284 |
| Molecular Formula | C22H21F3N4O5 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | ethyl 3-[3-(2-methoxyethoxy)-5-[[2-(trifluoromethyl)-4-pyridinyl]carbamoyl]phenyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cncn1-c1cc(OCCOC)cc(C(=O)Nc2ccnc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H21F3N4O5/c1-3-33-21(31)18-12-26-13-29(18)16-8-14(9-17(11-16)34-7-6-32-2)20(30)28-15-4-5-27-19(10-15)22(23,24)25/h4-5,8-13H,3,6-7H2,1-2H3,(H,27,28,30) |
| InChIKey | XNDLHZWOAKPFNR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|