About 2-oxoethyl 6-aminohexanoate
2-oxoethyl 6-aminohexanoate (PubChem CID 171573291) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-oxoethyl 6-aminohexanoate.
Molecular Properties
| Compound Name | 2-oxoethyl 6-aminohexanoate |
| PubChem CID | 171573291 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2-oxoethyl 6-aminohexanoate |
| SMILES | NCCCCCC(=O)OCC=O |
| InChI | InChI=1S/C8H15NO3/c9-5-3-1-2-4-8(11)12-7-6-10/h6H,1-5,7,9H2 |
| InChIKey | QLMWNBMUDQWXSC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-oxoethyl 6-aminohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoethyl 6-aminohexanoate?
The IUPAC name of 2-oxoethyl 6-aminohexanoate (CID 171573291) is 2-oxoethyl 6-aminohexanoate.
What is the SMILES notation for 2-oxoethyl 6-aminohexanoate?
The canonical SMILES for 2-oxoethyl 6-aminohexanoate is NCCCCCC(=O)OCC=O.
What is the InChIKey of 2-oxoethyl 6-aminohexanoate?
The InChIKey is QLMWNBMUDQWXSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c9-5-3-1-2-4-8(11)12-7-6-10/h6H,1-5,7,9H2.
What are the key properties of 2-oxoethyl 6-aminohexanoate?
2-oxoethyl 6-aminohexanoate has a molecular weight of 173.21 g/mol, XLogP of 0.25, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoethyl 6-aminohexanoate is sourced from PubChem (CID 171573291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).