C32H38N2O2 — CID 171577010
N-[1-(adamantane-1-carbonylamino)naphthalen-2-yl]adamantane-1-carboxamide (PubChem CID 171577010) has the molecular formula C32H38N2O2 and a molecular weight of 482.67 g/mol. Its IUPAC name is N-[1-(adamantane-1-carbonylamino)naphthalen-2-yl]adamantane-1-carboxamide.
| Compound Name | N-[1-(adamantane-1-carbonylamino)naphthalen-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 171577010 |
| Molecular Formula | C32H38N2O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | N-[1-(adamantane-1-carbonylamino)naphthalen-2-yl]adamantane-1-carboxamide |
| SMILES | O=C(Nc1ccc2ccccc2c1NC(=O)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H38N2O2/c35-29(31-13-19-7-20(14-31)9-21(8-19)15-31)33-27-6-5-25-3-1-2-4-26(25)28(27)34-30(36)32-16-22-10-23(17-32)12-24(11-22)18-32/h1-6,19-24H,7-18H2,(H,33,35)(H,34,36) |
| InChIKey | FYKPZMGFDUUTKA-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |