C28H29N5O4 — CID 171586062
benzyl N-[6-(2-hydroxy-4-isocyanophenyl)-5-methylpyridazin-3-yl]-N-[(3R)-1-(oxetan-3-yl)piperidin-3-yl]carbamate (PubChem CID 171586062) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is benzyl N-[6-(2-hydroxy-4-isocyanophenyl)-5-methylpyridazin-3-yl]-N-[(3R)-1-(oxetan-3-yl)piperidin-3-yl]carbamate.
| Compound Name | benzyl N-[6-(2-hydroxy-4-isocyanophenyl)-5-methylpyridazin-3-yl]-N-[(3R)-1-(oxetan-3-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 171586062 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | benzyl N-[6-(2-hydroxy-4-isocyanophenyl)-5-methylpyridazin-3-yl]-N-[(3R)-1-(oxetan-3-yl)piperidin-3-yl]carbamate |
| SMILES | [C-]#[N+]c1ccc(-c2nnc(N(C(=O)OCc3ccccc3)[C@@H]3CCCN(C4COC4)C3)cc2C)c(O)c1 |
| InChI | InChI=1S/C28H29N5O4/c1-19-13-26(30-31-27(19)24-11-10-21(29-2)14-25(24)34)33(28(35)37-16-20-7-4-3-5-8-20)22-9-6-12-32(15-22)23-17-36-18-23/h3-5,7-8,10-11,13-14,22-23,34H,6,9,12,15-18H2,1H3/t22-/m1/s1 |
| InChIKey | AEYBOHLGGHEVHH-JOCHJYFZSA-N |
| XLogP | 4.71 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|