C23H29ClN4O3 — CID 171586088
benzyl N-(6-chloro-5-methylpyridazin-3-yl)-N-[(3R)-1-(oxan-4-yl)piperidin-3-yl]carbamate (PubChem CID 171586088) has the molecular formula C23H29ClN4O3 and a molecular weight of 444.96 g/mol. Its IUPAC name is benzyl N-(6-chloro-5-methylpyridazin-3-yl)-N-[(3R)-1-(oxan-4-yl)piperidin-3-yl]carbamate.
| Compound Name | benzyl N-(6-chloro-5-methylpyridazin-3-yl)-N-[(3R)-1-(oxan-4-yl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 171586088 |
| Molecular Formula | C23H29ClN4O3 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | benzyl N-(6-chloro-5-methylpyridazin-3-yl)-N-[(3R)-1-(oxan-4-yl)piperidin-3-yl]carbamate |
| SMILES | Cc1cc(N(C(=O)OCc2ccccc2)[C@@H]2CCCN(C3CCOCC3)C2)nnc1Cl |
| InChI | InChI=1S/C23H29ClN4O3/c1-17-14-21(25-26-22(17)24)28(23(29)31-16-18-6-3-2-4-7-18)20-8-5-11-27(15-20)19-9-12-30-13-10-19/h2-4,6-7,14,19-20H,5,8-13,15-16H2,1H3/t20-/m1/s1 |
| InChIKey | VJGKGBCPNAQEBY-HXUWFJFHSA-N |
| XLogP | 4.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |