C21H17FN4O4 — CID 171588120
2-(2,6-dioxopiperidin-3-yl)-6-[(6-fluoro-3-pyridinyl)methyl]-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione (PubChem CID 171588120) has the molecular formula C21H17FN4O4 and a molecular weight of 408.39 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-6-[(6-fluoro-3-pyridinyl)methyl]-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-6-[(6-fluoro-3-pyridinyl)methyl]-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171588120 |
| Molecular Formula | C21H17FN4O4 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-6-[(6-fluoro-3-pyridinyl)methyl]-5,7-dihydropyrrolo[3,4-f]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cc4c(cc3C2=O)CN(Cc2ccc(F)nc2)C4)C(=O)N1 |
| InChI | InChI=1S/C21H17FN4O4/c22-17-3-1-11(7-23-17)8-25-9-12-5-14-15(6-13(12)10-25)21(30)26(20(14)29)16-2-4-18(27)24-19(16)28/h1,3,5-7,16H,2,4,8-10H2,(H,24,27,28) |
| InChIKey | BQYKICDLADQERS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|