C27H29FN4O5 — CID 171598711
1-[5-fluoro-1-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]-3-methyl-2-oxobenzimidazol-4-yl]piperidine-4-carbaldehyde (PubChem CID 171598711) has the molecular formula C27H29FN4O5 and a molecular weight of 508.55 g/mol. Its IUPAC name is 1-[5-fluoro-1-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]-3-methyl-2-oxobenzimidazol-4-yl]piperidine-4-carbaldehyde.
| Compound Name | 1-[5-fluoro-1-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]-3-methyl-2-oxobenzimidazol-4-yl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 171598711 |
| Molecular Formula | C27H29FN4O5 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 1-[5-fluoro-1-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]-3-methyl-2-oxobenzimidazol-4-yl]piperidine-4-carbaldehyde |
| SMILES | COc1ccc(CN2C(=O)CCC(n3c(=O)n(C)c4c(N5CCC(C=O)CC5)c(F)ccc43)C2=O)cc1 |
| InChI | InChI=1S/C27H29FN4O5/c1-29-25-21(8-7-20(28)24(25)30-13-11-18(16-33)12-14-30)32(27(29)36)22-9-10-23(34)31(26(22)35)15-17-3-5-19(37-2)6-4-17/h3-8,16,18,22H,9-15H2,1-2H3 |
| InChIKey | VBEIQJKTBSJMFH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 93.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|