C21H19BrFN3O4 — CID 169121013
3-(5-bromo-4-fluoro-3-methyl-2-oxobenzimidazol-1-yl)-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione (PubChem CID 169121013) has the molecular formula C21H19BrFN3O4 and a molecular weight of 476.30 g/mol. Its IUPAC name is 3-(5-bromo-4-fluoro-3-methyl-2-oxobenzimidazol-1-yl)-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione.
| Compound Name | 3-(5-bromo-4-fluoro-3-methyl-2-oxobenzimidazol-1-yl)-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169121013 |
| Molecular Formula | C21H19BrFN3O4 |
| Molecular Weight | 476.30 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 3-(5-bromo-4-fluoro-3-methyl-2-oxobenzimidazol-1-yl)-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione |
| SMILES | COc1ccc(CN2C(=O)CCC(n3c(=O)n(C)c4c(F)c(Br)ccc43)C2=O)cc1 |
| InChI | InChI=1S/C21H19BrFN3O4/c1-24-19-15(8-7-14(22)18(19)23)26(21(24)29)16-9-10-17(27)25(20(16)28)11-12-3-5-13(30-2)6-4-12/h3-8,16H,9-11H2,1-2H3 |
| InChIKey | NTBFDNHNAJZHRN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|