C20H17BrN2O5 — CID 138694206
3-(7-bromo-2-oxo-1,3-benzoxazol-3-yl)-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione (PubChem CID 138694206) has the molecular formula C20H17BrN2O5 and a molecular weight of 445.27 g/mol. Its IUPAC name is 3-(7-bromo-2-oxo-1,3-benzoxazol-3-yl)-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione.
| Compound Name | 3-(7-bromo-2-oxo-1,3-benzoxazol-3-yl)-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 138694206 |
| Molecular Formula | C20H17BrN2O5 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 3-(7-bromo-2-oxo-1,3-benzoxazol-3-yl)-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione |
| SMILES | COc1ccc(CN2C(=O)CCC(n3c(=O)oc4c(Br)cccc43)C2=O)cc1 |
| InChI | InChI=1S/C20H17BrN2O5/c1-27-13-7-5-12(6-8-13)11-22-17(24)10-9-16(19(22)25)23-15-4-2-3-14(21)18(15)28-20(23)26/h2-8,16H,9-11H2,1H3 |
| InChIKey | KEMPRPKEMZWMPF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 81.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|