C23H22BrN3O4 — CID 164566952
3-(4-bromo-3-cyclopropyl-2-oxobenzimidazol-1-yl)-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione (PubChem CID 164566952) has the molecular formula C23H22BrN3O4 and a molecular weight of 484.35 g/mol. Its IUPAC name is 3-(4-bromo-3-cyclopropyl-2-oxobenzimidazol-1-yl)-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione.
| Compound Name | 3-(4-bromo-3-cyclopropyl-2-oxobenzimidazol-1-yl)-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164566952 |
| Molecular Formula | C23H22BrN3O4 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 3-(4-bromo-3-cyclopropyl-2-oxobenzimidazol-1-yl)-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione |
| SMILES | COc1ccc(CN2C(=O)CCC(n3c(=O)n(C4CC4)c4c(Br)cccc43)C2=O)cc1 |
| InChI | InChI=1S/C23H22BrN3O4/c1-31-16-9-5-14(6-10-16)13-25-20(28)12-11-19(22(25)29)27-18-4-2-3-17(24)21(18)26(23(27)30)15-7-8-15/h2-6,9-10,15,19H,7-8,11-13H2,1H3 |
| InChIKey | DSVZMSQFSKBUDS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|