C27H32N4O8 — CID 138695854
2-[2-[2-[3-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]-2-oxobenzimidazol-1-yl]ethoxy]ethoxy]ethylcarbamic acid (PubChem CID 138695854) has the molecular formula C27H32N4O8 and a molecular weight of 540.57 g/mol. Its IUPAC name is 2-[2-[2-[3-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]-2-oxobenzimidazol-1-yl]ethoxy]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[2-[3-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]-2-oxobenzimidazol-1-yl]ethoxy]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 138695854 |
| Molecular Formula | C27H32N4O8 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 2-[2-[2-[3-[1-[(4-methoxyphenyl)methyl]-2,6-dioxopiperidin-3-yl]-2-oxobenzimidazol-1-yl]ethoxy]ethoxy]ethylcarbamic acid |
| SMILES | COc1ccc(CN2C(=O)CCC(n3c(=O)n(CCOCCOCCNC(=O)O)c4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C27H32N4O8/c1-37-20-8-6-19(7-9-20)18-30-24(32)11-10-23(25(30)33)31-22-5-3-2-4-21(22)29(27(31)36)13-15-39-17-16-38-14-12-28-26(34)35/h2-9,23,28H,10-18H2,1H3,(H,34,35) |
| InChIKey | WKFNBFHWHOIUPK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|