C30H38N4O6 — CID 170262359
3-[4-[4-(dimethoxymethyl)piperidin-1-yl]-3,5-dimethyl-2-oxobenzimidazol-1-yl]-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione (PubChem CID 170262359) has the molecular formula C30H38N4O6 and a molecular weight of 550.66 g/mol. Its IUPAC name is 3-[4-[4-(dimethoxymethyl)piperidin-1-yl]-3,5-dimethyl-2-oxobenzimidazol-1-yl]-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[4-(dimethoxymethyl)piperidin-1-yl]-3,5-dimethyl-2-oxobenzimidazol-1-yl]-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170262359 |
| Molecular Formula | C30H38N4O6 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 3-[4-[4-(dimethoxymethyl)piperidin-1-yl]-3,5-dimethyl-2-oxobenzimidazol-1-yl]-1-[(4-methoxyphenyl)methyl]piperidine-2,6-dione |
| SMILES | COc1ccc(CN2C(=O)CCC(n3c(=O)n(C)c4c(N5CCC(C(OC)OC)CC5)c(C)ccc43)C2=O)cc1 |
| InChI | InChI=1S/C30H38N4O6/c1-19-6-11-23-27(26(19)32-16-14-21(15-17-32)29(39-4)40-5)31(2)30(37)34(23)24-12-13-25(35)33(28(24)36)18-20-7-9-22(38-3)10-8-20/h6-11,21,24,29H,12-18H2,1-5H3 |
| InChIKey | YIZUBRLOLJCEMB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 95.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|