C17H20N2O9S — CID 1716
2-[[4-(2-carboxypyrrolidin-1-yl)sulfonylbenzoyl]amino]pentanedioic acid (PubChem CID 1716) has the molecular formula C17H20N2O9S and a molecular weight of 428.42 g/mol. Its IUPAC name is 2-[[4-(2-carboxypyrrolidin-1-yl)sulfonylbenzoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-(2-carboxypyrrolidin-1-yl)sulfonylbenzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 1716 |
| Molecular Formula | C17H20N2O9S |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-[[4-(2-carboxypyrrolidin-1-yl)sulfonylbenzoyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)c1ccc(S(=O)(=O)N2CCCC2C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C17H20N2O9S/c20-14(21)8-7-12(16(23)24)18-15(22)10-3-5-11(6-4-10)29(27,28)19-9-1-2-13(19)17(25)26/h3-6,12-13H,1-2,7-9H2,(H,18,22)(H,20,21)(H,23,24)(H,25,26) |
| InChIKey | NDDOUBGQRWFVQM-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |