C18H36NO10P — CID 171600635
2-[5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-4-yl]oxyethoxy-ethylphosphinic acid (PubChem CID 171600635) has the molecular formula C18H36NO10P and a molecular weight of 457.46 g/mol. Its IUPAC name is 2-[5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-4-yl]oxyethoxy-ethylphosphinic acid.
| Compound Name | 2-[5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-4-yl]oxyethoxy-ethylphosphinic acid |
|---|---|
| PubChem CID | 171600635 |
| Molecular Formula | C18H36NO10P |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 2-[5-acetamido-3-hydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-4-yl]oxyethoxy-ethylphosphinic acid |
| SMILES | CCP(=O)(O)OCCOC1C(O)C(CO)OC(OCCOC(C)(C)C)C1NC(C)=O |
| InChI | InChI=1S/C18H36NO10P/c1-6-30(23,24)28-10-8-25-16-14(19-12(2)21)17(29-13(11-20)15(16)22)26-7-9-27-18(3,4)5/h13-17,20,22H,6-11H2,1-5H3,(H,19,21)(H,23,24) |
| InChIKey | HPFBQVZTSKFEMQ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 153.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|