C18H38NO9P — CID 153447698
2-[5-amino-4-hydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-3-yl]oxyethoxy-tert-butylphosphinic acid (PubChem CID 153447698) has the molecular formula C18H38NO9P and a molecular weight of 443.47 g/mol. Its IUPAC name is 2-[5-amino-4-hydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-3-yl]oxyethoxy-tert-butylphosphinic acid.
| Compound Name | 2-[5-amino-4-hydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-3-yl]oxyethoxy-tert-butylphosphinic acid |
|---|---|
| PubChem CID | 153447698 |
| Molecular Formula | C18H38NO9P |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 2-[5-amino-4-hydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-3-yl]oxyethoxy-tert-butylphosphinic acid |
| SMILES | CC(C)(C)OCCOC1OC(CO)C(OCCOP(=O)(O)C(C)(C)C)C(O)C1N |
| InChI | InChI=1S/C18H38NO9P/c1-17(2,3)26-9-7-25-16-13(19)14(21)15(12(11-20)28-16)24-8-10-27-29(22,23)18(4,5)6/h12-16,20-21H,7-11,19H2,1-6H3,(H,22,23) |
| InChIKey | REWOVFKAUDLGHU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 149.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|