C15H31O9P — CID 153447700
[4,5-dihydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-3-yl]oxy-propan-2-ylphosphinic acid (PubChem CID 153447700) has the molecular formula C15H31O9P and a molecular weight of 386.38 g/mol. Its IUPAC name is [4,5-dihydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-3-yl]oxy-propan-2-ylphosphinic acid.
| Compound Name | [4,5-dihydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-3-yl]oxy-propan-2-ylphosphinic acid |
|---|---|
| PubChem CID | 153447700 |
| Molecular Formula | C15H31O9P |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [4,5-dihydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-3-yl]oxy-propan-2-ylphosphinic acid |
| SMILES | CC(C)P(=O)(O)OC1C(CO)OC(OCCOC(C)(C)C)C(O)C1O |
| InChI | InChI=1S/C15H31O9P/c1-9(2)25(19,20)24-13-10(8-16)23-14(12(18)11(13)17)21-6-7-22-15(3,4)5/h9-14,16-18H,6-8H2,1-5H3,(H,19,20) |
| InChIKey | PEIZDROQONESLD-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|