C19H38NO10P — CID 153447669
2-[5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-3-yl]oxyethoxy-propan-2-ylphosphinic acid (PubChem CID 153447669) has the molecular formula C19H38NO10P and a molecular weight of 471.48 g/mol. Its IUPAC name is 2-[5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-3-yl]oxyethoxy-propan-2-ylphosphinic acid.
| Compound Name | 2-[5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-3-yl]oxyethoxy-propan-2-ylphosphinic acid |
|---|---|
| PubChem CID | 153447669 |
| Molecular Formula | C19H38NO10P |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 2-[5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]oxan-3-yl]oxyethoxy-propan-2-ylphosphinic acid |
| SMILES | CC(=O)NC1C(OCCOC(C)(C)C)OC(CO)C(OCCOP(=O)(O)C(C)C)C1O |
| InChI | InChI=1S/C19H38NO10P/c1-12(2)31(24,25)29-10-8-26-17-14(11-21)30-18(15(16(17)23)20-13(3)22)27-7-9-28-19(4,5)6/h12,14-18,21,23H,7-11H2,1-6H3,(H,20,22)(H,24,25) |
| InChIKey | VJBVAVNVVPITAS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 153.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|