C32H47BrO2S — CID 171608428
6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde (PubChem CID 171608428) has the molecular formula C32H47BrO2S and a molecular weight of 575.70 g/mol. Its IUPAC name is 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde.
| Compound Name | 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 171608428 |
| Molecular Formula | C32H47BrO2S |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde |
| SMILES | CCCCCCC1(CCCCCC)c2cc(Br)c(OCC(CC)CCCC)cc2-c2sc(C=O)cc21 |
| InChI | InChI=1S/C32H47BrO2S/c1-5-9-12-14-17-32(18-15-13-10-6-2)27-21-29(33)30(35-23-24(8-4)16-11-7-3)20-26(27)31-28(32)19-25(22-34)36-31/h19-22,24H,5-18,23H2,1-4H3 |
| InChIKey | VUZMXDSUOKAHMX-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|