About 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde
6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde (PubChem CID 171608428) has the molecular formula C32H47BrO2S
and a molecular weight of 575.70 g/mol. Its IUPAC name is 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde.
Molecular Properties
| Compound Name | 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde |
| PubChem CID | 171608428 |
| Molecular Formula | C32H47BrO2S |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde |
| SMILES | CCCCCCC1(CCCCCC)c2cc(Br)c(OCC(CC)CCCC)cc2-c2sc(C=O)cc21 |
| InChI | InChI=1S/C32H47BrO2S/c1-5-9-12-14-17-32(18-15-13-10-6-2)27-21-29(33)30(35-23-24(8-4)16-11-7-3)20-26(27)31-28(32)19-25(22-34)36-31/h19-22,24H,5-18,23H2,1-4H3 |
| InChIKey | VUZMXDSUOKAHMX-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde?
The IUPAC name of 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde (CID 171608428) is 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde.
What is the SMILES notation for 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde?
The canonical SMILES for 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde is CCCCCCC1(CCCCCC)c2cc(Br)c(OCC(CC)CCCC)cc2-c2sc(C=O)cc21.
What is the InChIKey of 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde?
The InChIKey is VUZMXDSUOKAHMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H47BrO2S/c1-5-9-12-14-17-32(18-15-13-10-6-2)27-21-29(33)30(35-23-24(8-4)16-11-7-3)20-26(27)31-28(32)19-25(22-34)36-31/h19-22,24H,5-18,23H2,1-4H3.
What are the key properties of 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde?
6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde has a molecular weight of 575.70 g/mol, XLogP of 11.13, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-7-(2-ethylhexoxy)-4,4-dihexylindeno[1,2-b]thiophene-2-carbaldehyde is sourced from PubChem (CID 171608428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).