C7H13O6PS — CID 171608483
3-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]thiane 1,1-dioxide (PubChem CID 171608483) has the molecular formula C7H13O6PS and a molecular weight of 256.22 g/mol. Its IUPAC name is 3-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]thiane 1,1-dioxide.
| Compound Name | 3-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 171608483 |
| Molecular Formula | C7H13O6PS |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 3-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]thiane 1,1-dioxide |
| SMILES | O=P1(OC2CCCS(=O)(=O)C2)OCCO1 |
| InChI | InChI=1S/C7H13O6PS/c8-14(11-3-4-12-14)13-7-2-1-5-15(9,10)6-7/h7H,1-6H2 |
| InChIKey | RZSVJYYQUXCNEP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|