C23H20Cl2N2O2 — CID 171612271
2-chloro-N-[2-(2-chlorophenyl)ethyl]-5-(3-cyclopropylphenoxy)pyridine-4-carboxamide (PubChem CID 171612271) has the molecular formula C23H20Cl2N2O2 and a molecular weight of 427.33 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-chlorophenyl)ethyl]-5-(3-cyclopropylphenoxy)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[2-(2-chlorophenyl)ethyl]-5-(3-cyclopropylphenoxy)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 171612271 |
| Molecular Formula | C23H20Cl2N2O2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2-chloro-N-[2-(2-chlorophenyl)ethyl]-5-(3-cyclopropylphenoxy)pyridine-4-carboxamide |
| SMILES | O=C(NCCc1ccccc1Cl)c1cc(Cl)ncc1Oc1cccc(C2CC2)c1 |
| InChI | InChI=1S/C23H20Cl2N2O2/c24-20-7-2-1-4-16(20)10-11-26-23(28)19-13-22(25)27-14-21(19)29-18-6-3-5-17(12-18)15-8-9-15/h1-7,12-15H,8-11H2,(H,26,28) |
| InChIKey | XHWYZMFRPMAJBX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|