C20H18ClN6+ — CID 171615059
7-chloro-N-[1-[6-(3-methylimidazol-3-ium-1-yl)-3-pyridinyl]ethylideneamino]quinolin-4-amine (PubChem CID 171615059) has the molecular formula C20H18ClN6+ and a molecular weight of 377.86 g/mol. Its IUPAC name is 7-chloro-N-[1-[6-(3-methylimidazol-3-ium-1-yl)-3-pyridinyl]ethylideneamino]quinolin-4-amine.
| Compound Name | 7-chloro-N-[1-[6-(3-methylimidazol-3-ium-1-yl)-3-pyridinyl]ethylideneamino]quinolin-4-amine |
|---|---|
| PubChem CID | 171615059 |
| Molecular Formula | C20H18ClN6+ |
| Molecular Weight | 377.86 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 7-chloro-N-[1-[6-(3-methylimidazol-3-ium-1-yl)-3-pyridinyl]ethylideneamino]quinolin-4-amine |
| SMILES | CC(=NNc1ccnc2cc(Cl)ccc12)c1ccc(-n2cc[n+](C)c2)nc1 |
| InChI | InChI=1S/C20H18ClN6/c1-14(15-3-6-20(23-12-15)27-10-9-26(2)13-27)24-25-18-7-8-22-19-11-16(21)4-5-17(18)19/h3-13H,1-2H3,(H,22,25)/q+1 |
| InChIKey | IZGIDDIVGGNKCO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.86 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|