C14H13F3N4O2 — CID 171616211
[5-(trifluoromethyl)-8-oxa-1,3,14,15-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5,11,13-pentaen-13-yl]methanol (PubChem CID 171616211) has the molecular formula C14H13F3N4O2 and a molecular weight of 326.28 g/mol. Its IUPAC name is [5-(trifluoromethyl)-8-oxa-1,3,14,15-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5,11,13-pentaen-13-yl]methanol.
| Compound Name | [5-(trifluoromethyl)-8-oxa-1,3,14,15-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5,11,13-pentaen-13-yl]methanol |
|---|---|
| PubChem CID | 171616211 |
| Molecular Formula | C14H13F3N4O2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [5-(trifluoromethyl)-8-oxa-1,3,14,15-tetrazatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5,11,13-pentaen-13-yl]methanol |
| SMILES | OCc1cc2n(n1)CCN1c3ncc(C(F)(F)F)cc3OCC21 |
| InChI | InChI=1S/C14H13F3N4O2/c15-14(16,17)8-3-12-13(18-5-8)20-1-2-21-10(11(20)7-23-12)4-9(6-22)19-21/h3-5,11,22H,1-2,6-7H2 |
| InChIKey | HFPBUDDKZIRPEG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |