C18H19N5O5 — CID 171619257
2-[[7-[(2,4-dimethoxyphenyl)methylamino]-1-methylpyrazolo[5,4-c]pyridin-4-yl]amino]-2-oxoacetic acid (PubChem CID 171619257) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-[[7-[(2,4-dimethoxyphenyl)methylamino]-1-methylpyrazolo[5,4-c]pyridin-4-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[7-[(2,4-dimethoxyphenyl)methylamino]-1-methylpyrazolo[5,4-c]pyridin-4-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 171619257 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[[7-[(2,4-dimethoxyphenyl)methylamino]-1-methylpyrazolo[5,4-c]pyridin-4-yl]amino]-2-oxoacetic acid |
| SMILES | COc1ccc(CNc2ncc(NC(=O)C(=O)O)c3cnn(C)c23)c(OC)c1 |
| InChI | InChI=1S/C18H19N5O5/c1-23-15-12(8-21-23)13(22-17(24)18(25)26)9-20-16(15)19-7-10-4-5-11(27-2)6-14(10)28-3/h4-6,8-9H,7H2,1-3H3,(H,19,20)(H,22,24)(H,25,26) |
| InChIKey | VLLARYLMEJEPOW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|