C21H21ClFN3O — CID 171622010
N-[(2-chloro-4-cyanophenyl)methyl]-1-[(4-fluorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 171622010) has the molecular formula C21H21ClFN3O and a molecular weight of 385.87 g/mol. Its IUPAC name is N-[(2-chloro-4-cyanophenyl)methyl]-1-[(4-fluorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[(2-chloro-4-cyanophenyl)methyl]-1-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 171622010 |
| Molecular Formula | C21H21ClFN3O |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-[(2-chloro-4-cyanophenyl)methyl]-1-[(4-fluorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | N#Cc1ccc(CNC(=O)C2CCN(Cc3ccc(F)cc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C21H21ClFN3O/c22-20-11-16(12-24)1-4-18(20)13-25-21(27)17-7-9-26(10-8-17)14-15-2-5-19(23)6-3-15/h1-6,11,17H,7-10,13-14H2,(H,25,27) |
| InChIKey | NECPIRFAJLQNCF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |