C21H30N4O2 — CID 171622151
ethane;2-methoxy-4-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-3-carboxamide (PubChem CID 171622151) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is ethane;2-methoxy-4-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-3-carboxamide.
| Compound Name | ethane;2-methoxy-4-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622151 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | ethane;2-methoxy-4-methyl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-3-carboxamide |
| SMILES | CC.COc1nccc(C)c1C(=O)Nc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C19H24N4O2.C2H6/c1-14-8-9-20-19(25-3)17(14)18(24)21-15-4-6-16(7-5-15)23-12-10-22(2)11-13-23;1-2/h4-9H,10-13H2,1-3H3,(H,21,24);1-2H3 |
| InChIKey | MNRDCNJVRXDJHY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|