C18H21IN4O2 — CID 171622667
4-iodo-2-methoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-3-carboxamide (PubChem CID 171622667) has the molecular formula C18H21IN4O2 and a molecular weight of 452.30 g/mol. Its IUPAC name is 4-iodo-2-methoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-3-carboxamide.
| Compound Name | 4-iodo-2-methoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622667 |
| Molecular Formula | C18H21IN4O2 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 4-iodo-2-methoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]pyridine-3-carboxamide |
| SMILES | COc1nccc(I)c1C(=O)Nc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C18H21IN4O2/c1-22-9-11-23(12-10-22)14-5-3-13(4-6-14)21-17(24)16-15(19)7-8-20-18(16)25-2/h3-8H,9-12H2,1-2H3,(H,21,24) |
| InChIKey | ZMLFJGDXHOOBFO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|