C29H33N7O4 — CID 171622697
ethane;2-methoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[(8-nitroisoquinolin-4-yl)amino]pyridine-3-carboxamide (PubChem CID 171622697) has the molecular formula C29H33N7O4 and a molecular weight of 543.63 g/mol. Its IUPAC name is ethane;2-methoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[(8-nitroisoquinolin-4-yl)amino]pyridine-3-carboxamide.
| Compound Name | ethane;2-methoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[(8-nitroisoquinolin-4-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171622697 |
| Molecular Formula | C29H33N7O4 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | ethane;2-methoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]-4-[(8-nitroisoquinolin-4-yl)amino]pyridine-3-carboxamide |
| SMILES | CC.COc1nccc(Nc2cncc3c([N+](=O)[O-])cccc23)c1C(=O)Nc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C27H27N7O4.C2H6/c1-32-12-14-33(15-13-32)19-8-6-18(7-9-19)30-26(35)25-22(10-11-29-27(25)38-2)31-23-17-28-16-21-20(23)4-3-5-24(21)34(36)37;1-2/h3-11,16-17H,12-15H2,1-2H3,(H,29,31)(H,30,35);1-2H3 |
| InChIKey | IOKYJSLWKVGWBA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|