C12H18N4O2 — CID 171622631
(E,2E)-3-[[(1E,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]amino]-2-(hydroxymethylidene)-5-methyliminopent-3-enal (PubChem CID 171622631) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (E,2E)-3-[[(1E,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]amino]-2-(hydroxymethylidene)-5-methyliminopent-3-enal.
| Compound Name | (E,2E)-3-[[(1E,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]amino]-2-(hydroxymethylidene)-5-methyliminopent-3-enal |
|---|---|
| PubChem CID | 171622631 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (E,2E)-3-[[(1E,3Z)-1,4-diamino-2-methylbuta-1,3-dienyl]amino]-2-(hydroxymethylidene)-5-methyliminopent-3-enal |
| SMILES | C/N=C/C=C(N/C(N)=C(C)/C=C\N)\C(C=O)=C/O |
| InChI | InChI=1S/C12H18N4O2/c1-9(3-5-13)12(14)16-11(4-6-15-2)10(7-17)8-18/h3-8,16-17H,13-14H2,1-2H3/b5-3-,10-7-,11-4+,12-9+,15-6+ |
| InChIKey | SVEOYVOXYTVSSX-NLTPYDKQSA-N |
| XLogP | 0.46 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|