C25H31N6O3P — CID 171624205
4-[[(1R,9R)-8-(6-dimethylphosphoryl-2-pyridinyl)-1,11,11-trimethyl-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-yl]amino]-1-methylpyridin-2-one (PubChem CID 171624205) has the molecular formula C25H31N6O3P and a molecular weight of 494.54 g/mol. Its IUPAC name is 4-[[(1R,9R)-8-(6-dimethylphosphoryl-2-pyridinyl)-1,11,11-trimethyl-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-yl]amino]-1-methylpyridin-2-one.
| Compound Name | 4-[[(1R,9R)-8-(6-dimethylphosphoryl-2-pyridinyl)-1,11,11-trimethyl-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-yl]amino]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 171624205 |
| Molecular Formula | C25H31N6O3P |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 4-[[(1R,9R)-8-(6-dimethylphosphoryl-2-pyridinyl)-1,11,11-trimethyl-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-yl]amino]-1-methylpyridin-2-one |
| SMILES | Cn1ccc(Nc2ncc3c(n2)N(c2cccc(P(C)(C)=O)n2)[C@@H]2CC(C)(C)OC[C@]32C)cc1=O |
| InChI | InChI=1S/C25H31N6O3P/c1-24(2)13-18-25(3,15-34-24)17-14-26-23(27-16-10-11-30(4)21(32)12-16)29-22(17)31(18)19-8-7-9-20(28-19)35(5,6)33/h7-12,14,18H,13,15H2,1-6H3,(H,26,27,29)/t18-,25-/m1/s1 |
| InChIKey | CIJAKZXLPJAOMX-IQGLISFBSA-N |
| XLogP | 3.54 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|