C34H44N8O2 — CID 171624168
5,5-dimethyl-1-[6-[(1R,9R)-1,11,11-trimethyl-5-[4-(4-methylpiperazin-1-yl)anilino]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-8-yl]-2-pyridinyl]pyrrolidin-2-one (PubChem CID 171624168) has the molecular formula C34H44N8O2 and a molecular weight of 596.78 g/mol. Its IUPAC name is 5,5-dimethyl-1-[6-[(1R,9R)-1,11,11-trimethyl-5-[4-(4-methylpiperazin-1-yl)anilino]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-8-yl]-2-pyridinyl]pyrrolidin-2-one.
| Compound Name | 5,5-dimethyl-1-[6-[(1R,9R)-1,11,11-trimethyl-5-[4-(4-methylpiperazin-1-yl)anilino]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-8-yl]-2-pyridinyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 171624168 |
| Molecular Formula | C34H44N8O2 |
| Molecular Weight | 596.78 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | 5,5-dimethyl-1-[6-[(1R,9R)-1,11,11-trimethyl-5-[4-(4-methylpiperazin-1-yl)anilino]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-8-yl]-2-pyridinyl]pyrrolidin-2-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(n3)N(c3cccc(N5C(=O)CCC5(C)C)n3)[C@@H]3CC(C)(C)OC[C@]43C)cc2)CC1 |
| InChI | InChI=1S/C34H44N8O2/c1-32(2)15-14-29(43)42(32)28-9-7-8-27(37-28)41-26-20-33(3,4)44-22-34(26,5)25-21-35-31(38-30(25)41)36-23-10-12-24(13-11-23)40-18-16-39(6)17-19-40/h7-13,21,26H,14-20,22H2,1-6H3,(H,35,36,38)/t26-,34-/m1/s1 |
| InChIKey | JZQPOJHOELWGIZ-OOXUFLSTSA-N |
| XLogP | 5.25 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.78 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|