C32H40N8O3 — CID 171624084
(4R)-4-methyl-3-[6-[(1R,9R)-1,11,11-trimethyl-5-[4-(4-methylpiperazin-1-yl)anilino]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-8-yl]-2-pyridinyl]-1,3-oxazolidin-2-one (PubChem CID 171624084) has the molecular formula C32H40N8O3 and a molecular weight of 584.73 g/mol. Its IUPAC name is (4R)-4-methyl-3-[6-[(1R,9R)-1,11,11-trimethyl-5-[4-(4-methylpiperazin-1-yl)anilino]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-8-yl]-2-pyridinyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-methyl-3-[6-[(1R,9R)-1,11,11-trimethyl-5-[4-(4-methylpiperazin-1-yl)anilino]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-8-yl]-2-pyridinyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 171624084 |
| Molecular Formula | C32H40N8O3 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | (4R)-4-methyl-3-[6-[(1R,9R)-1,11,11-trimethyl-5-[4-(4-methylpiperazin-1-yl)anilino]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-8-yl]-2-pyridinyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H]1COC(=O)N1c1cccc(N2c3nc(Nc4ccc(N5CCN(C)CC5)cc4)ncc3[C@@]3(C)COC(C)(C)C[C@@H]23)n1 |
| InChI | InChI=1S/C32H40N8O3/c1-21-19-42-30(41)39(21)26-7-6-8-27(35-26)40-25-17-31(2,3)43-20-32(25,4)24-18-33-29(36-28(24)40)34-22-9-11-23(12-10-22)38-15-13-37(5)14-16-38/h6-12,18,21,25H,13-17,19-20H2,1-5H3,(H,33,34,36)/t21-,25-,32-/m1/s1 |
| InChIKey | LWNFPERPELKLRL-NZERDHAXSA-N |
| XLogP | 4.69 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|