C30H39N7O2 — CID 174332167
(1R,9R)-8-[6-[(dimethylamino)methyl]-2-pyridinyl]-1,11,11-trimethyl-N-(4-morpholin-4-ylphenyl)-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine (PubChem CID 174332167) has the molecular formula C30H39N7O2 and a molecular weight of 529.69 g/mol. Its IUPAC name is (1R,9R)-8-[6-[(dimethylamino)methyl]-2-pyridinyl]-1,11,11-trimethyl-N-(4-morpholin-4-ylphenyl)-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine.
| Compound Name | (1R,9R)-8-[6-[(dimethylamino)methyl]-2-pyridinyl]-1,11,11-trimethyl-N-(4-morpholin-4-ylphenyl)-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine |
|---|---|
| PubChem CID | 174332167 |
| Molecular Formula | C30H39N7O2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | (1R,9R)-8-[6-[(dimethylamino)methyl]-2-pyridinyl]-1,11,11-trimethyl-N-(4-morpholin-4-ylphenyl)-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine |
| SMILES | CN(C)Cc1cccc(N2c3nc(Nc4ccc(N5CCOCC5)cc4)ncc3[C@@]3(C)COC(C)(C)C[C@@H]23)n1 |
| InChI | InChI=1S/C30H39N7O2/c1-29(2)17-25-30(3,20-39-29)24-18-31-28(33-21-9-11-23(12-10-21)36-13-15-38-16-14-36)34-27(24)37(25)26-8-6-7-22(32-26)19-35(4)5/h6-12,18,25H,13-17,19-20H2,1-5H3,(H,31,33,34)/t25-,30-/m1/s1 |
| InChIKey | BLKHMDQLUCVXGP-FYBSXPHGSA-N |
| XLogP | 4.49 |
| TPSA | 78.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|